EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15ClN2O5 |
| Net Charge | 0 |
| Average Mass | 374.780 |
| Monoisotopic Mass | 374.06695 |
| SMILES | COCCOc1cccc2c1c(=O)c(C(=O)O)nn2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClN2O5/c1-25-9-10-26-14-4-2-3-13-15(14)17(22)16(18(23)24)20-21(13)12-7-5-11(19)6-8-12/h2-8H,9-10H2,1H3,(H,23,24) |
| InChIKey | QLMNCUHSDAGQGT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | chemical hybridisation agent A plant growth regulator that produces male sterility in plants by preventing pollen development, pollen shed, or pollen viability. This makes the plant adaptable to hybridization without the need for laborious hand pollination. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sintofen (CHEBI:133130) has role chemical hybridisation agent (CHEBI:133106) |
| sintofen (CHEBI:133130) is a aromatic ether (CHEBI:35618) |
| sintofen (CHEBI:133130) is a cinnolines (CHEBI:38770) |
| sintofen (CHEBI:133130) is a monocarboxylic acid (CHEBI:25384) |
| sintofen (CHEBI:133130) is a monochlorobenzenes (CHEBI:83403) |
| IUPAC Name |
|---|
| 1-(4-chlorophenyl)-5-(2-methoxyethoxy)-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| 1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxocinnoline-3-carboxylic acid | Alan Wood's Pesticides |
| sintofène | ChEBI |
| 1-(4-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxo-3-cinnolinecarboxylic acid | Alan Wood's Pesticides |
| cintofen | Alan Wood's Pesticides |
| 1-(p-chlorophenyl)-5-(2-methoxyethoxy)-4-oxo-1,4-dihydrocinnoline-3-carboxylic acid | ChEBI |
| 1-(p-chlorophenyl)-1,4-dihydro-5-(2-methoxyethoxy)-4-oxo-3-cinnolinecarboxylic acid | ChEBI |
| Brand Names | Source |
|---|---|
| CROISOR | ChEBI |
| Croisor 100 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14836299 | Reaxys |
| CAS:130561-48-7 | ChemIDplus |
| CAS:130561-48-7 | Alan Wood's Pesticides |