EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H62N8O6S |
| Net Charge | 0 |
| Average Mass | 783.053 |
| Monoisotopic Mass | 782.45130 |
| SMILES | CC(C)C[C@H]1NC(=O)[C@H](Cc2cnc3ccccc23)NC(=O)[C@@H](C(C)C)NC(=O)[C@@H]2CSC(N2)[C@H](C(C)C)NC(=O)[C@@H](C(C)C)NC(=O)[C@H](C(C)C)NC1=O |
| InChI | InChI=1S/C40H62N8O6S/c1-19(2)15-27-35(50)45-31(21(5)6)38(53)47-32(22(7)8)39(54)48-33(23(9)10)40-44-29(18-55-40)36(51)46-30(20(3)4)37(52)43-28(34(49)42-27)16-24-17-41-26-14-12-11-13-25(24)26/h11-14,17,19-23,27-33,40-41,44H,15-16,18H2,1-10H3,(H,42,49)(H,43,52)(H,45,50)(H,46,51)(H,47,53)(H,48,54)/t27-,28+,29+,30-,31+,32-,33+,40?/m1/s1 |
| InChIKey | QZNGYMKAHFFKCJ-ZBQZSICZSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (27466123) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (27466123) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lugdunin (CHEBI:133127) has role human metabolite (CHEBI:77746) |
| lugdunin (CHEBI:133127) has role rat metabolite (CHEBI:86264) |
| lugdunin (CHEBI:133127) is a homodetic cyclic peptide (CHEBI:24613) |
| lugdunin (CHEBI:133127) is a indoles (CHEBI:24828) |
| lugdunin (CHEBI:133127) is a macrocycle (CHEBI:51026) |
| lugdunin (CHEBI:133127) is a peptide antibiotic (CHEBI:25903) |
| lugdunin (CHEBI:133127) is a thiazolidines (CHEBI:35622) |
| IUPAC Name |
|---|
| (1R,4R,7S,10R,13S,16R,19S)-7-[(1H-indol-3-yl)methyl]-10-(2-methylpropyl)-4,13,16,19-tetra(propan-2-yl)-21-thia-3,6,9,12,15,18,23-heptaazabicyclo[18.2.1]tricosane-2,5,8,11,14,17-hexone |
| Manual Xrefs | Databases |
|---|---|
| Lugdunin | Wikipedia |
| Citations |
|---|