EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O8S2 |
| Net Charge | 0 |
| Average Mass | 450.575 |
| Monoisotopic Mass | 450.13821 |
| SMILES | [H][C@@]12CCC3=C[C@@H](OS(=O)(=O)O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)[C@@H](OS(=O)(=O)O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H30O8S2/c1-18-9-7-13(26-28(20,21)22)11-12(18)3-4-14-15-5-6-17(27-29(23,24)25)19(15,2)10-8-16(14)18/h11,13-17H,3-10H2,1-2H3,(H,20,21,22)(H,23,24,25)/t13-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | UWPTUYJASNIIJM-LOVVWNRFSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-androstene-3β,17β-diol disulfate (CHEBI:133124) is a steroid sulfate (CHEBI:16158) |
| 4-androstene-3β,17β-diol disulfate (CHEBI:133124) is conjugate acid of 4-androstene-3β,17β-diol disulfate anion (CHEBI:133123) |
| 4-androstene-3β,17β-diol disulfate (CHEBI:133124) is conjugate acid of 4-androstene-3β,17β-diol disulfate(2−) (CHEBI:133126) |
| Incoming Relation(s) |
| 4-androstene-3β,17β-diol disulfate anion (CHEBI:133123) is conjugate base of 4-androstene-3β,17β-diol disulfate (CHEBI:133124) |
| 4-androstene-3β,17β-diol disulfate(2−) (CHEBI:133126) is conjugate base of 4-androstene-3β,17β-diol disulfate (CHEBI:133124) |
| IUPAC Name |
|---|
| androst-4-ene-3β,17β-diyl bis(hydrogen sulfate) |
| Synonym | Source |
|---|---|
| (3β,17β)-androst-4-ene-3,17-diyl bis(hydrogen sulfate) | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:29608273 | Reaxys |