EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H34O8S2 |
| Net Charge | -2 |
| Average Mass | 478.629 |
| Monoisotopic Mass | 478.17061 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)OS(=O)(=O)[O-])[C@@]1(C)CC[C@H](OS(=O)(=O)[O-])C2 |
| InChI | InChI=1S/C21H36O8S2/c1-13(28-30(22,23)24)17-6-7-18-16-5-4-14-12-15(29-31(25,26)27)8-10-20(14,2)19(16)9-11-21(17,18)3/h13-19H,4-12H2,1-3H3,(H,22,23,24)(H,25,26,27)/p-2/t13-,14-,15-,16-,17+,18-,19-,20-,21+/m0/s1 |
| InChIKey | LSQGWMYMIHQKSA-ZVPCKFNKSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-pregnane-3β,20α-diol disulfate(2−) (CHEBI:133121) is a 5α-pregnane-3β,20α-diol disulfate anion (CHEBI:133118) |
| 5α-pregnane-3β,20α-diol disulfate(2−) (CHEBI:133121) is conjugate base of 5α-pregnane-3β,20α-diol disulfate (CHEBI:133119) |
| Incoming Relation(s) |
| 5α-pregnane-3β,20α-diol disulfate (CHEBI:133119) is conjugate acid of 5α-pregnane-3β,20α-diol disulfate(2−) (CHEBI:133121) |
| IUPAC Name |
|---|
| (20S)-5α-pregnane-3β,20-diyl disulfate |
| Synonym | Source |
|---|---|
| (3β,5α,20S)-pregnane-3,20-diyl disulfate | IUPAC |