EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H32O8S2 |
| Net Charge | 0 |
| Average Mass | 452.591 |
| Monoisotopic Mass | 452.15386 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@H](OS(=O)(=O)O)CC[C@@]34[H])[C@@]1(C)CC[C@H](OS(=O)(=O)O)C2 |
| InChI | InChI=1S/C19H32O8S2/c1-18-9-7-13(26-28(20,21)22)11-12(18)3-4-14-15-5-6-17(27-29(23,24)25)19(15,2)10-8-16(14)18/h12-17H,3-11H2,1-2H3,(H,20,21,22)(H,23,24,25)/t12-,13-,14-,15-,16-,17+,18-,19-/m0/s1 |
| InChIKey | JHFAETDERBWUOO-MFXFBURESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-androstane-3β,17α-diol disulfate (CHEBI:133112) has functional parent 5α-androstane-3β,17α-diol (CHEBI:40836) |
| 5α-androstane-3β,17α-diol disulfate (CHEBI:133112) is a androstane sulfate (CHEBI:131647) |
| 5α-androstane-3β,17α-diol disulfate (CHEBI:133112) is conjugate acid of 5α-androstane-3β,17α-diol disulfate anion (CHEBI:133111) |
| 5α-androstane-3β,17α-diol disulfate (CHEBI:133112) is conjugate acid of 5α-androstane-3β,17α-diol disulfate(2−) (CHEBI:133113) |
| Incoming Relation(s) |
| 5α-androstane-3β,17α-diol disulfate anion (CHEBI:133111) is conjugate base of 5α-androstane-3β,17α-diol disulfate (CHEBI:133112) |
| 5α-androstane-3β,17α-diol disulfate(2−) (CHEBI:133113) is conjugate base of 5α-androstane-3β,17α-diol disulfate (CHEBI:133112) |
| IUPAC Name |
|---|
| 5α-androstane-3β,17α-diyl bis(hydrogen sulfate) |
| Synonym | Source |
|---|---|
| (3β,5α,17α)-androstane-3,17-diyl bis(hydrogen sulfate) | IUPAC |