EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H10ClN2O3.K |
| Net Charge | 0 |
| Average Mass | 316.785 |
| Monoisotopic Mass | 316.00170 |
| SMILES | CCc1c(C(=O)[O-])c(=O)cnn1-c1ccc(Cl)cc1.[K+] |
| InChI | InChI=1S/C13H11ClN2O3.K/c1-2-10-12(13(18)19)11(17)7-15-16(10)9-5-3-8(14)4-6-9;/h3-7H,2H2,1H3,(H,18,19);/q;+1/p-1 |
| InChIKey | NUUZKOFSZIWYSC-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Role: | chemical hybridisation agent A plant growth regulator that produces male sterility in plants by preventing pollen development, pollen shed, or pollen viability. This makes the plant adaptable to hybridization without the need for laborious hand pollination. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofencet-potassium (CHEBI:133108) has part clofencet(1−) (CHEBI:133107) |
| clofencet-potassium (CHEBI:133108) has role chemical hybridisation agent (CHEBI:133106) |
| clofencet-potassium (CHEBI:133108) is a potassium salt (CHEBI:26218) |
| IUPAC Name |
|---|
| potassium 2-(4-chlorophenyl)-3-ethyl-5-oxo-2,5-dihydropyridazine-4-carboxylate |
| Synonyms | Source |
|---|---|
| clofencet potassium | ChemIDplus |
| clofencet potassium salt | ChemIDplus |
| potassium 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylate | ChEBI |
| potassium 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylate | ChEBI |
| potassium 2-(p-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylate | ChEBI |
| potassium 2-(p-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| derivatives/clofencet-potassium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:14558338 | Reaxys |
| CAS:82697-71-0 | Alan Wood's Pesticides |
| CAS:82697-71-0 | ChemIDplus |