EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H31O5S |
| Net Charge | -1 |
| Average Mass | 371.519 |
| Monoisotopic Mass | 371.18977 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OS(=O)(=O)[O-])CC[C@@]34[H])[C@@]1(C)CC[C@@H](O)C2 |
| InChI | InChI=1S/C19H32O5S/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(24-25(21,22)23)19(15,2)10-8-16(14)18/h12-17,20H,3-11H2,1-2H3,(H,21,22,23)/p-1/t12-,13+,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | KWYNDVHEQWYGIL-KHOSGYARSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3α,5α,17β)-3-hydroxyandrostan-17-yl sulfate(1−) (CHEBI:133105) is a steroid sulfate oxoanion (CHEBI:59696) |
| (3α,5α,17β)-3-hydroxyandrostan-17-yl sulfate(1−) (CHEBI:133105) is conjugate base of (3α,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:133103) |
| Incoming Relation(s) |
| (3α,5α,17β)-3-hydroxyandrostan-17-yl sulfate (CHEBI:133103) is conjugate acid of (3α,5α,17β)-3-hydroxyandrostan-17-yl sulfate(1−) (CHEBI:133105) |
| Synonyms | Source |
|---|---|
| 3α-hydroxy-5α-androstan-17β-yl sulfate | ChEBI |
| 5alpha-androstan-3alpha,17beta-diol 17-monosulfate | ChEBI |
| 5alpha-androstan-3alpha,17beta-diol monosulfate | ChEBI |
| 5α-androstane-3α,17β-diol 17-monosulfate | ChEBI |
| UniProt Name | Source |
|---|---|
| (3α,5α,17β)-3-hydroxy-androstan-17-yl sulfate | UniProt |