EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11ClN2O3 |
| Net Charge | 0 |
| Average Mass | 278.695 |
| Monoisotopic Mass | 278.04582 |
| SMILES | CCc1c(C(=O)O)c(=O)cnn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H11ClN2O3/c1-2-10-12(13(18)19)11(17)7-15-16(10)9-5-3-8(14)4-6-9/h3-7H,2H2,1H3,(H,18,19) |
| InChIKey | PIZCXVUFSNPNON-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | chemical hybridisation agent A plant growth regulator that produces male sterility in plants by preventing pollen development, pollen shed, or pollen viability. This makes the plant adaptable to hybridization without the need for laborious hand pollination. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clofencet (CHEBI:133104) has role chemical hybridisation agent (CHEBI:133106) |
| clofencet (CHEBI:133104) is a biaryl (CHEBI:64459) |
| clofencet (CHEBI:133104) is a monocarboxylic acid (CHEBI:25384) |
| clofencet (CHEBI:133104) is a monochlorobenzenes (CHEBI:83403) |
| clofencet (CHEBI:133104) is a pyridazinone (CHEBI:26414) |
| clofencet (CHEBI:133104) is conjugate acid of clofencet(1−) (CHEBI:133107) |
| Incoming Relation(s) |
| clofencet(1−) (CHEBI:133107) is conjugate base of clofencet (CHEBI:133104) |
| IUPAC Name |
|---|
| 2-(4-chlorophenyl)-3-ethyl-5-oxo-2,5-dihydropyridazine-4-carboxylic acid |
| Synonyms | Source |
|---|---|
| 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylic acid | Alan Wood's Pesticides |
| 2-(4-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylic acid | Alan Wood's Pesticides |
| 2-(p-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxo-4-pyridazinecarboxylic acid | ChEBI |
| 2-(p-chlorophenyl)-3-ethyl-2,5-dihydro-5-oxopyridazine-4-carboxylic acid | ChEBI |
| 2-(p-chlorophenyl)-3-ethyl-5-oxo-2,5-dihydropyridazine-4-carboxylic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8913954 | Reaxys |
| CAS:129025-54-3 | Alan Wood's Pesticides |
| CAS:129025-54-3 | ChemIDplus |
| Citations |
|---|