EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O8S2 |
| Net Charge | -2 |
| Average Mass | 450.575 |
| Monoisotopic Mass | 450.13931 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OS(=O)(=O)[O-])CC[C@@]34[H])[C@@]1(C)CC[C@@H](OS(=O)(=O)[O-])C2 |
| InChI | InChI=1S/C19H32O8S2/c1-18-9-7-13(26-28(20,21)22)11-12(18)3-4-14-15-5-6-17(27-29(23,24)25)19(15,2)10-8-16(14)18/h12-17H,3-11H2,1-2H3,(H,20,21,22)(H,23,24,25)/p-2/t12-,13+,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | JHFAETDERBWUOO-KHOSGYARSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-androstane-3α,17β-diol disulfate(2−) (CHEBI:133102) is a 5α-androstane-3α,17β-diol disulfate anion (CHEBI:133100) |
| 5α-androstane-3α,17β-diol disulfate(2−) (CHEBI:133102) is conjugate base of 5α-androstane-3α,17β-diol disulfate (CHEBI:133101) |
| Incoming Relation(s) |
| 5α-androstane-3α,17β-diol disulfate (CHEBI:133101) is conjugate acid of 5α-androstane-3α,17β-diol disulfate(2−) (CHEBI:133102) |
| IUPAC Name |
|---|
| 5α-androstane-3α,17β-diyl disulfate |
| Synonyms | Source |
|---|---|
| 5α-androstan-3α,17β-diol disulfate dianion | ChEBI |
| (3α,5α,17β)-androstane-3,17-diyl disulfate | IUPAC |