EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18N2O2 |
| Net Charge | 0 |
| Average Mass | 210.277 |
| Monoisotopic Mass | 210.13683 |
| SMILES | [H][C@@]12CCCN1C(=O)[C@H](CC(C)C)NC2=O |
| InChI | InChI=1S/C11H18N2O2/c1-7(2)6-8-11(15)13-5-3-4-9(13)10(14)12-8/h7-9H,3-6H2,1-2H3,(H,12,14)/t8-,9-/m0/s1 |
| InChIKey | SZJNCZMRZAUNQT-IUCAKERBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Achromobacter xylosoxidans (ncbitaxon:85698) | - | PubMed (15574949) | |
| Bacillus amyloliquefaciens (ncbitaxon:1390) | - | PubMed (24698790) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cyclo(L-Leu-L-Pro) (CHEBI:133094) has role bacterial metabolite (CHEBI:76969) |
| cyclo(L-Leu-L-Pro) (CHEBI:133094) has role marine metabolite (CHEBI:76507) |
| cyclo(L-Leu-L-Pro) (CHEBI:133094) is a dipeptide (CHEBI:46761) |
| cyclo(L-Leu-L-Pro) (CHEBI:133094) is a homodetic cyclic peptide (CHEBI:24613) |
| cyclo(L-Leu-L-Pro) (CHEBI:133094) is a pyrrolopyrazine (CHEBI:48337) |
| IUPAC Name |
|---|
| (3S,8aS)-3-(2-methylpropyl)hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| Synonyms | Source |
|---|---|
| cyclo(L-leucyl-L-prolyl) | ChEBI |
| cyclo(Leu-Pro) | ChEBI |
| Gancidin W | ChemIDplus |
| Cyclo-L-leu-L-pro | ChemIDplus |
| L-cyclo(Leu-pro) | HMDB |
| cyclo(L-Pro-L-Leu) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0034276 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:85716 | Reaxys |
| CAS:2873-36-1 | ChemIDplus |
| Citations |
|---|