EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H34O4 |
| Net Charge | 0 |
| Average Mass | 314.466 |
| Monoisotopic Mass | 314.24571 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O4/c19-17(20)15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18(21)22/h1-16H2,(H,19,20)(H,21,22) |
| InChIKey | BNJOQKFENDDGSC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octadecanedioic acid (CHEBI:133086) has parent hydride octadecane (CHEBI:32926) |
| octadecanedioic acid (CHEBI:133086) is a α,ω-dicarboxylic acid (CHEBI:28383) |
| octadecanedioic acid (CHEBI:133086) is conjugate acid of octadecanedioate (CHEBI:133087) |
| octadecanedioic acid (CHEBI:133086) is conjugate acid of octadecanedioic acid anion (CHEBI:133088) |
| Incoming Relation(s) |
| octadecanedioate (CHEBI:133087) is conjugate base of octadecanedioic acid (CHEBI:133086) |
| octadecanedioic acid anion (CHEBI:133088) is conjugate base of octadecanedioic acid (CHEBI:133086) |
| IUPAC Name |
|---|
| octadecanedioic acid |
| Synonyms | Source |
|---|---|
| 1,16-Hexadecanedicarboxylic acid | HMDB |
| 1,18-Octadecadioic acid | NIST Chemistry WebBook |
| 1,18-octadecanedioic acid | ChEBI |
| Octadecane-1,18-dioic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0000782 | HMDB |
| LMFA01170029 | LIPID MAPS |