EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18NO6 |
| Net Charge | -1 |
| Average Mass | 260.266 |
| Monoisotopic Mass | 260.11396 |
| SMILES | CC(C(=O)[O-])C(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C11H19NO6/c1-7(10(15)16)11(17)18-8(5-9(13)14)6-12(2,3)4/h7-8H,5-6H2,1-4H3,(H-,13,14,15,16)/p-1 |
| InChIKey | XROYFEWIXXCPAW-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methylmalonylcarnitine(1−) (CHEBI:133076) is a dicarboxylic acid monoanion (CHEBI:35695) |
| O-methylmalonylcarnitine(1−) (CHEBI:133076) is conjugate base of O-methylmalonylcarnitine (CHEBI:73031) |
| Incoming Relation(s) |
| O-methylmalonylcarnitine (CHEBI:73031) is conjugate acid of O-methylmalonylcarnitine(1−) (CHEBI:133076) |
| IUPAC Name |
|---|
| 3-[(2-carboxylatopropanoyl)oxy]-4-(trimethylazaniumyl)butanoate |
| Synonyms | Source |
|---|---|
| 2-methylmalonyl carnitine | ChEBI |
| 2-methylmalonylcarnitine(1−) | ChEBI |
| O-methylmalonylcarnitine(1−) | ChEBI |
| methylmalonylcarnitine(1−) | ChEBI |