EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H44NO7S |
| Net Charge | -1 |
| Average Mass | 514.705 |
| Monoisotopic Mass | 514.28440 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=O)NCCS(=O)(=O)[O-])[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@@H](O)C[C@@]3([H])[C@H](O)[C@H](O)[C@@]21[H] |
| InChI | InChI=1S/C26H45NO7S/c1-15(4-7-21(29)27-12-13-35(32,33)34)17-5-6-18-22-19(9-11-25(17,18)2)26(3)10-8-16(28)14-20(26)23(30)24(22)31/h15-20,22-24,28,30-31H,4-14H2,1-3H3,(H,27,29)(H,32,33,34)/p-1/t15-,16-,17-,18+,19+,20+,22+,23+,24-,25-,26-/m1/s1 |
| InChIKey | XSOLDPYUICCHJX-UZUDEGBHSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23395169) | |
| Rattus norvegicus (ncbitaxon:10116) | - | PubMed (6825837) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tauro-β-muricholate (CHEBI:133064) has role human metabolite (CHEBI:77746) |
| tauro-β-muricholate (CHEBI:133064) has role rat metabolite (CHEBI:86264) |
| tauro-β-muricholate (CHEBI:133064) is a cholanic acid conjugate anion (CHEBI:131879) |
| tauro-β-muricholate (CHEBI:133064) is a organosulfonate oxoanion (CHEBI:33554) |
| tauro-β-muricholate (CHEBI:133064) is conjugate base of tauro-β-muricholic acid (CHEBI:133057) |
| Incoming Relation(s) |
| tauro-β-muricholic acid (CHEBI:133057) is conjugate acid of tauro-β-muricholate (CHEBI:133064) |
| IUPAC Name |
|---|
| 2-[(3α,6β,7β-trihydroxy-24-oxo-5β-cholan-24-yl)amino]ethane-1-sulfonate |
| Synonyms | Source |
|---|---|
| 2-{[(3α,5β,6β,7β)-3,6,7-trihydroxy-24-oxocholan-24-yl]amino}ethane-1-sulfonate | IUPAC |
| N-(3α,6β,7β-trihydroxy-5β-cholan-24-oyl)-taurinate | ChEBI |
| tauro-beta-muricholate | ChEBI |
| β-tauromuricholate | ChEBI |
| UniProt Name | Source |
|---|---|
| tauro-β-muricholate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-18800 | MetaCyc |
| Citations |
|---|