EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O5 |
| Net Charge | 0 |
| Average Mass | 402.531 |
| Monoisotopic Mass | 402.24062 |
| SMILES | CC(=O)O[C@@H]1C(C)=CC(=O)[C@]2(C/C=C(\C)CC/C=C(\C)CC/C=C(\C)CO)O[C@H]12 |
| InChI | InChI=1S/C24H34O5/c1-16(9-7-11-18(3)15-25)8-6-10-17(2)12-13-24-21(27)14-19(4)22(23(24)29-24)28-20(5)26/h8,11-12,14,22-23,25H,6-7,9-10,13,15H2,1-5H3/b16-8+,17-12+,18-11+/t22-,23-,24+/m1/s1 |
| InChIKey | ULUIYCOUZXIMPX-XXMQOAAMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger ATCC 1015 (ncbitaxon:380704) | - | PubMed (25293978) | Strain: KB1001 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| yanuthone L (CHEBI:133034) has functional parent yanuthone K (CHEBI:133035) |
| yanuthone L (CHEBI:133034) has role Aspergillus metabolite (CHEBI:76956) |
| yanuthone L (CHEBI:133034) has role antifungal agent (CHEBI:35718) |
| yanuthone L (CHEBI:133034) is a acetate ester (CHEBI:47622) |
| yanuthone L (CHEBI:133034) is a class I yanuthone (CHEBI:133075) |
| yanuthone L (CHEBI:133034) is a primary alcohol (CHEBI:15734) |
| IUPAC Name |
|---|
| (1R,2R,6R)-6-[(2E,6E,10E)-12-hydroxy-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-3-methyl-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-2-yl acetate |
| Synonym | Source |
|---|---|
| yanuthone-L | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27991880 | Reaxys |
| Citations |
|---|