EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H18N3O5 |
| Net Charge | -1 |
| Average Mass | 332.336 |
| Monoisotopic Mass | 332.12519 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C16H19N3O5/c17-11(15(21)22)5-6-14(20)19-13(16(23)24)7-9-8-18-12-4-2-1-3-10(9)12/h1-4,8,11,13,18H,5-7,17H2,(H,19,20)(H,21,22)(H,23,24)/p-1/t11-,13-/m0/s1 |
| InChIKey | CATMPQFFVNKDEY-AAEUAGOBSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-Glu-Trp(1−) (CHEBI:133030) is a peptide anion (CHEBI:60334) |
| γ-Glu-Trp(1−) (CHEBI:133030) is conjugate base of γ-Glu-Trp (CHEBI:133028) |
| Incoming Relation(s) |
| γ-Glu-Trp (CHEBI:133028) is conjugate acid of γ-Glu-Trp(1−) (CHEBI:133030) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(1S)-1-carboxylato-2-(1H-indol-3-yl)ethyl]amino}-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| L-γ-Glu-L-Trp(1−) | ChEBI |
| L-γ-glutamyl-L-tryptophan(1−) | ChEBI |
| γ-glutamyltryptophan | ChEBI |