EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H24Cl2N2O7S |
| Net Charge | 0 |
| Average Mass | 615.491 |
| Monoisotopic Mass | 614.06813 |
| SMILES | CS(=O)(=O)c1cccc(C[C@H](NC(=O)c2c(Cl)cc3c(c2Cl)CCN(C(=O)c2ccc4ccoc4c2)C3)C(=O)O)c1 |
| InChI | InChI=1S/C29H24Cl2N2O7S/c1-41(38,39)20-4-2-3-16(11-20)12-23(29(36)37)32-27(34)25-22(30)13-19-15-33(9-7-21(19)26(25)31)28(35)18-6-5-17-8-10-40-24(17)14-18/h2-6,8,10-11,13-14,23H,7,9,12,15H2,1H3,(H,32,34)(H,36,37)/t23-/m0/s1 |
| InChIKey | JFOZKMSJYSPYLN-QHCPKHFHSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | lymphocyte function-associated antigen-1 antagonist Any antagonist of lymphocyte function-associated antigen-1 |
| Application: | anti-inflammatory drug A substance that reduces or suppresses inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lifitegrast (CHEBI:133023) has role anti-inflammatory drug (CHEBI:35472) |
| lifitegrast (CHEBI:133023) has role lymphocyte function-associated antigen-1 antagonist (CHEBI:133024) |
| lifitegrast (CHEBI:133023) is a N-acyl-L-α-amino acid (CHEBI:48927) |
| lifitegrast (CHEBI:133023) is a L-phenylalanine derivative (CHEBI:84144) |
| lifitegrast (CHEBI:133023) is a 1-benzofurans (CHEBI:38830) |
| lifitegrast (CHEBI:133023) is a isoquinolines (CHEBI:24922) |
| lifitegrast (CHEBI:133023) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| N-[2-(1-benzofuran-6-carbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl]-3-(methanesulfonyl)-L-phenylalanine |
| INN | Source |
|---|---|
| lifitegrast | KEGG DRUG |
| Synonyms | Source |
|---|---|
| SAR-1118 | ChemIDplus |
| SAR 1118 | ChemIDplus |
| SAR1118 | ChEBI |
| Brand Name | Source |
|---|---|
| Xiidra | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10374 | KEGG DRUG |
| Lifitegrast | Wikipedia |
| 5174 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19179816 | Reaxys |
| CAS:1025967-78-5 | KEGG DRUG |
| CAS:1025967-78-5 | ChemIDplus |
| Citations |
|---|