EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H12ClNO2 |
| Net Charge | 0 |
| Average Mass | 261.708 |
| Monoisotopic Mass | 261.05566 |
| SMILES | O=C1C2=C(CCCC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12ClNO2/c15-9-5-7-10(8-6-9)16-13(17)11-3-1-2-4-12(11)14(16)18/h5-8H,1-4H2 |
| InChIKey | MJQBFSWPMMHVSM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor An EC 1.3.3.* (oxidoreductase acting on donor CH-CH group with oxygen as acceptor) inhibitor that interferes with the action of protoporphyrinogen oxidase (EC 1.3.3.4). |
| Application: | herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorphthalim (CHEBI:133019) has role EC 1.3.3.4 (protoporphyrinogen oxidase) inhibitor (CHEBI:73192) |
| chlorphthalim (CHEBI:133019) has role herbicide (CHEBI:24527) |
| chlorphthalim (CHEBI:133019) is a maleimides (CHEBI:55417) |
| chlorphthalim (CHEBI:133019) is a monochlorobenzenes (CHEBI:83403) |
| chlorphthalim (CHEBI:133019) is a phthalimides (CHEBI:82851) |
| IUPAC Name |
|---|
| 2-(4-chlorophenyl)-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione |
| Synonyms | Source |
|---|---|
| Chlorindrin | ChemIDplus |
| N-(4-chlorophenyl)-3,4,5,6-tetrahydrophthalimide | Alan Wood's Pesticides |
| N-(4-chlorophenyl)cyclohex-1-ene-1,2-dicarboximide | Alan Wood's Pesticides |
| N-(p-chlorophenyl)-3,4,5,6-tetrahydrophthalimide | ChemIDplus |
| N-(p-chlorophenyl)cyclohex-1-ene-1,2-dicarboximide | ChEBI |
| Brand Name | Source |
|---|---|
| Diamate | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:39985-63-2 | ChemIDplus |
| CAS:39985-63-2 | Alan Wood's Pesticides |
| CAS:88402-43-1 | ChemIDplus |