EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18NO9 |
| Net Charge | -1 |
| Average Mass | 356.307 |
| Monoisotopic Mass | 356.09870 |
| SMILES | COc1cc(O[C@@H]2O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)ccc1NC(C)=O |
| InChI | InChI=1S/C15H19NO9/c1-6(17)16-8-4-3-7(5-9(8)23-2)24-15-12(20)10(18)11(19)13(25-15)14(21)22/h3-5,10-13,15,18-20H,1-2H3,(H,16,17)(H,21,22)/p-1/t10-,11-,12+,13-,15+/m0/s1 |
| InChIKey | GDCCQRYSPGZVPX-DKBOKBLXSA-M |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxyacetaminophen glucuronide(1−) (CHEBI:133006) has role drug metabolite (CHEBI:49103) |
| 2-methoxyacetaminophen glucuronide(1−) (CHEBI:133006) is a β-D-glucosiduronate (CHEBI:83411) |
| 2-methoxyacetaminophen glucuronide(1−) (CHEBI:133006) is conjugate base of 2-methoxyacetaminophen glucuronide (CHEBI:133005) |
| Incoming Relation(s) |
| 2-methoxyacetaminophen glucuronide (CHEBI:133005) is conjugate acid of 2-methoxyacetaminophen glucuronide(1−) (CHEBI:133006) |
| IUPAC Name |
|---|
| 4-acetamido-3-methoxyphenyl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| 2-methoxyacetaminophen β-D-glucuronide(1−) | ChEBI |
| 2-methoxyacetaminophen O-β-D-glucosiduronate | ChEBI |