EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29O5S |
| Net Charge | -1 |
| Average Mass | 369.503 |
| Monoisotopic Mass | 369.17412 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)C(=O)CC[C@@]34[H])[C@@]1(C)CC[C@@H](OS(=O)(=O)[O-])C2 |
| InChI | InChI=1S/C19H30O5S/c1-18-9-7-13(24-25(21,22)23)11-12(18)3-4-14-15-5-6-17(20)19(15,2)10-8-16(14)18/h12-16H,3-11H2,1-2H3,(H,21,22,23)/p-1/t12-,13+,14-,15-,16-,18-,19-/m0/s1 |
| InChIKey | ZMITXKRGXGRMKS-HLUDHZFRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| androsterone sulfate(1−) (CHEBI:133003) is a steroid sulfate oxoanion (CHEBI:59696) |
| androsterone sulfate(1−) (CHEBI:133003) is conjugate base of androsterone sulfate (CHEBI:83037) |
| Incoming Relation(s) |
| androsterone sulfate (CHEBI:83037) is conjugate acid of androsterone sulfate(1−) (CHEBI:133003) |
| IUPAC Name |
|---|
| 17-oxo-5α-androstan-3α-yl sulfate |
| Synonyms | Source |
|---|---|
| androsterone sulfate anion | ChEBI |
| (3α,5α)-17-oxoandrostan-3-yl sulfate | IUPAC |
| UniProt Name | Source |
|---|---|
| androsterone 3α-sulfate | UniProt |