EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36N4O6 |
| Net Charge | 0 |
| Average Mass | 584.673 |
| Monoisotopic Mass | 584.26348 |
| SMILES | C=CC1=C(C)/C(=C\c2nc(Cc3nc(/C=C4/NC(=O)C(C)=C4C=C)c(C)c3CCC(=O)O)c(CCC(=O)O)c2C)NC1=O |
| InChI | InChI=1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13+,27-14+ |
| InChIKey | BPYKTIZUTYGOLE-BMNRKXRESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E,E)-bilirubin (CHEBI:132996) is a biladienes (CHEBI:36735) |
| (E,E)-bilirubin (CHEBI:132996) is a dicarboxylic acid (CHEBI:35692) |
| (E,E)-bilirubin (CHEBI:132996) is conjugate acid of (E,E)-bilirubin anion (CHEBI:132995) |
| Incoming Relation(s) |
| (E,E)-bilirubin anion (CHEBI:132995) is conjugate base of (E,E)-bilirubin (CHEBI:132996) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:635396 | Reaxys |