EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO3S |
| Net Charge | 0 |
| Average Mass | 177.225 |
| Monoisotopic Mass | 177.04596 |
| SMILES | C=CC[S@](=O)C[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H11NO3S/c1-2-3-11(10)4-5(7)6(8)9/h2,5H,1,3-4,7H2,(H,8,9)/t5-,11-/m0/s1 |
| InChIKey | XUHLIQGRKRUKPH-DYEAUMGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Allium sativum (ncbitaxon:4682) | leaf (BTO:0000713) | PubMed (17262437) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| alliin zwitterion (CHEBI:132987) has role antimicrobial agent (CHEBI:33281) |
| alliin zwitterion (CHEBI:132987) has role antioxidant (CHEBI:22586) |
| alliin zwitterion (CHEBI:132987) has role cardioprotective agent (CHEBI:77307) |
| alliin zwitterion (CHEBI:132987) has role neuroprotective agent (CHEBI:63726) |
| alliin zwitterion (CHEBI:132987) has role plant metabolite (CHEBI:76924) |
| alliin zwitterion (CHEBI:132987) is a L-α-amino acid zwitterion (CHEBI:59869) |
| alliin zwitterion (CHEBI:132987) is tautomer of alliin (CHEBI:2596) |
| Incoming Relation(s) |
| alliin (CHEBI:2596) is tautomer of alliin zwitterion (CHEBI:132987) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-[(S)-prop-2-ene-1-sulfinyl]propanoate |
| UniProt Name | Source |
|---|---|
| alliin | UniProt |