EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H50N6O9S |
| Net Charge | 0 |
| Average Mass | 766.918 |
| Monoisotopic Mass | 766.33600 |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)O[C@@H]1C[C@H]1CCCCCc1nc3ccc(OC)cc3nc1O2)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C38H50N6O9S/c1-6-22-19-38(22,35(47)43-54(49,50)25-13-14-25)42-32(45)29-18-24-20-44(29)34(46)31(37(2,3)4)41-36(48)53-30-16-21(30)10-8-7-9-11-27-33(52-24)40-28-17-23(51-5)12-15-26(28)39-27/h6,12,15,17,21-22,24-25,29-31H,1,7-11,13-14,16,18-20H2,2-5H3,(H,41,48)(H,42,45)(H,43,47)/t21-,22-,24-,29+,30-,31-,38-/m1/s1 |
| InChIKey | OBMNJSNZOWALQB-NCQNOWPTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatitis C protease inhibitor An inhibitor of hepatitis C protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| grazoprevir (CHEBI:132975) has role antiviral drug (CHEBI:36044) |
| grazoprevir (CHEBI:132975) has role hepatitis C protease inhibitor (CHEBI:64924) |
| grazoprevir (CHEBI:132975) has role hepatoprotective agent (CHEBI:62868) |
| grazoprevir (CHEBI:132975) is a N-sulfonylcarboxamide (CHEBI:90852) |
| grazoprevir (CHEBI:132975) is a aromatic ether (CHEBI:35618) |
| grazoprevir (CHEBI:132975) is a azamacrocycle (CHEBI:52898) |
| grazoprevir (CHEBI:132975) is a carbamate ester (CHEBI:23003) |
| grazoprevir (CHEBI:132975) is a cyclopropanes (CHEBI:51454) |
| grazoprevir (CHEBI:132975) is a lactam (CHEBI:24995) |
| grazoprevir (CHEBI:132975) is a quinoxaline derivative (CHEBI:38771) |
| Incoming Relation(s) |
| Zepatier (CHEBI:132973) has part grazoprevir (CHEBI:132975) |
| IUPAC Name |
|---|
| (1aR,5S,8S,10R,22aR)-5-tert-butyl-N-{(1R,2S)-1-[(cyclopropanesulfonyl)carbamoyl]-2-ethenylcyclopropyl}-14-methoxy-3,6-dioxo-1,1a,3,4,5,6,9,10,18,19,20,21,22,22a-tetradecahydro-8H-7,10-methanocyclopropa[18,19][1,10,3,6]dioxadiazacyclononadecino[11,12-b]quinoxaline-8-carboxamide |
| INN | Source |
|---|---|
| grazoprevir | ChemIDplus |
| Synonym | Source |
|---|---|
| MK 5172 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 5081 | DrugCentral |
| Grazoprevir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19999739 | Reaxys |
| CAS:1350514-68-9 | ChemIDplus |
| Citations |
|---|