EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19N3O6 |
| Net Charge | 0 |
| Average Mass | 445.431 |
| Monoisotopic Mass | 445.12739 |
| SMILES | [H]C(=C1C(=O)N(c2ccc(C(=O)O)cc2)N=C1C)c1ccc(-c2cc(C)c(C)cc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C24H19N3O6/c1-13-10-20(21(27(31)32)11-14(13)2)22-9-8-18(33-22)12-19-15(3)25-26(23(19)28)17-6-4-16(5-7-17)24(29)30/h4-12H,1-3H3,(H,29,30) |
| InChIKey | HEKJYZZSCQBJGB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. EC 2.3.1.48 (histone acetyltransferase) inhibitor An EC 2.3.1.* (acyltransferase transferring other than amino-acyl group) inhibitor that interferes with the function of histone acetyltransferase (EC 2.3.1.48). |
| Application: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C646 (CHEBI:132974) has role apoptosis inducer (CHEBI:68495) |
| C646 (CHEBI:132974) has role EC 2.3.1.48 (histone acetyltransferase) inhibitor (CHEBI:76395) |
| C646 (CHEBI:132974) has role radiosensitizing agent (CHEBI:132992) |
| C646 (CHEBI:132974) is a C-nitro compound (CHEBI:35716) |
| C646 (CHEBI:132974) is a benzoic acids (CHEBI:22723) |
| C646 (CHEBI:132974) is a biaryl (CHEBI:64459) |
| C646 (CHEBI:132974) is a furans (CHEBI:24129) |
| C646 (CHEBI:132974) is a pyrazolone (CHEBI:83328) |
| IUPAC Name |
|---|
| 4-(4-{[5-(4,5-dimethyl-2-nitrophenyl)-2-furyl]methylene}-3-methyl-5-oxo-4,5-dihydro-1H-pyrazol-1-yl)benzoic acid |
| Synonym | Source |
|---|---|
| 4-[4-[[5-(4,5-Dimethyl-2-nitrophenyl)-2-furanyl]methylene]-4,5-dihydro-3-methyl-5-oxo-1H-pyrazol-1-yl]benzoic acid | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| LSM-6264 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20607912 | Reaxys |
| CAS:328968-36-1 | SUBMITTER |
| Citations |
|---|