EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3.HCl |
| Net Charge | 0 |
| Average Mass | 167.592 |
| Monoisotopic Mass | 167.03492 |
| SMILES | Cl.NCC(=O)CCC(=O)O |
| InChI | InChI=1S/C5H9NO3.ClH/c6-3-4(7)1-2-5(8)9;/h1-3,6H2,(H,8,9);1H |
| InChIKey | ZLHFONARZHCSET-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. dermatologic drug A drug used to treat or prevent skin disorders or for the routine care of skin. photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-aminolevulinic acid hydrochloride (CHEBI:132969) has part 5-ammoniolevulinic acid (CHEBI:132970) |
| 5-aminolevulinic acid hydrochloride (CHEBI:132969) has role antineoplastic agent (CHEBI:35610) |
| 5-aminolevulinic acid hydrochloride (CHEBI:132969) has role dermatologic drug (CHEBI:50177) |
| 5-aminolevulinic acid hydrochloride (CHEBI:132969) has role photosensitizing agent (CHEBI:47868) |
| 5-aminolevulinic acid hydrochloride (CHEBI:132969) has role prodrug (CHEBI:50266) |
| 5-aminolevulinic acid hydrochloride (CHEBI:132969) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 5-amino-4-oxopentanoic acid hydrochloride |
| 4-carboxy-2-oxobutan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| 5-aminolevulinic acid.HCl | ChEBI |
| Aminolevulinic acid hydrochloride | ChemIDplus |
| delta-Aminolevulinic acid hydrochloride | ChemIDplus |
| δ-aminolevulinic acid hydrochloride | ChEBI |
| Brand Names | Source |
|---|---|
| AMELUZ | ChEBI |
| Levulan | ChemIDplus |
| Levulan Kerastick | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D02908 | KEGG DRUG |
| DB00855 | DrugBank |
| Aminolevulinic_acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3690651 | Reaxys |
| CAS:5451-09-2 | KEGG DRUG |
| CAS:5451-09-2 | ChemIDplus |
| Citations |
|---|