EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H55N9O7 |
| Net Charge | 0 |
| Average Mass | 882.035 |
| Monoisotopic Mass | 881.42245 |
| SMILES | [H][C@@]1(c2ncc(-c3ccc4c(c3)O[C@@H](c3ccccc3)n3c-4cc4cc(-c5cnc([C@]6([H])CCCN6C(=O)[C@@H](NC(=O)OC)C(C)C)n5)ccc43)n2)CCCN1C(=O)[C@@H](NC(=O)OC)C(C)C |
| InChI | InChI=1S/C49H55N9O7/c1-27(2)41(54-48(61)63-5)45(59)56-20-10-14-37(56)43-50-25-34(52-43)30-17-19-36-32(22-30)23-39-33-18-16-31(24-40(33)65-47(58(36)39)29-12-8-7-9-13-29)35-26-51-44(53-35)38-15-11-21-57(38)46(60)42(28(3)4)55-49(62)64-6/h7-9,12-13,16-19,22-28,37-38,41-42,47H,10-11,14-15,20-21H2,1-6H3,(H,50,52)(H,51,53)(H,54,61)(H,55,62)/t37-,38-,41-,42-,47-/m0/s1 |
| InChIKey | BVAZQCUMNICBAQ-PZHYSIFUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | hepatitis C virus nonstructural protein 5A inhibitor Any inhibitor of hepatitis C virus nonstructural protein 5A. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. hepatoprotective agent Any compound that is able to prevent damage to the liver. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| elbasvir (CHEBI:132967) has role antiviral drug (CHEBI:36044) |
| elbasvir (CHEBI:132967) has role hepatitis C virus nonstructural protein 5A inhibitor (CHEBI:85185) |
| elbasvir (CHEBI:132967) has role hepatoprotective agent (CHEBI:62868) |
| elbasvir (CHEBI:132967) is a N-acylpyrrolidine (CHEBI:46766) |
| elbasvir (CHEBI:132967) is a L-valine derivative (CHEBI:84129) |
| elbasvir (CHEBI:132967) is a carbamate ester (CHEBI:23003) |
| elbasvir (CHEBI:132967) is a imidazoles (CHEBI:24780) |
| elbasvir (CHEBI:132967) is a organic heterotetracyclic compound (CHEBI:38163) |
| elbasvir (CHEBI:132967) is a ring assembly (CHEBI:36820) |
| Incoming Relation(s) |
| Zepatier (CHEBI:132973) has part elbasvir (CHEBI:132967) |
| IUPAC Name |
|---|
| methyl {(2S)-1-[(2S)-2-{4-[(6S)-3-{2-[(2S)-1-{(2S)-2-[(methoxycarbonyl)amino]-3-methylbutanoyl}pyrrolidin-2-yl]-1H-imidazol-4-yl}-6-phenyl-6H-indolo[1,2-c][1,3]benzoxazin-10-yl]-1H-imidazol-2-yl}pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl}carbamate |
| INN | Source |
|---|---|
| elbasvir | KEGG DRUG |
| Synonyms | Source |
|---|---|
| MK-8742 | ChemIDplus |
| MK8742 | ChemIDplus |
| MK 8742 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22434581 | Reaxys |
| CAS:1370468-36-2 | KEGG DRUG |
| CAS:1370468-36-2 | ChemIDplus |
| Citations |
|---|