EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H12N5O8P.2Na |
| Net Charge | 0 |
| Average Mass | 407.187 |
| Monoisotopic Mass | 407.02189 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)([O-])[O-])[C@@H](O)[C@H]3O)c2n1.[Na+].[Na+] |
| InChI | InChI=1S/C10H14N5O8P.2Na/c11-10-13-7-4(8(18)14-10)12-2-15(7)9-6(17)5(16)3(23-9)1-22-24(19,20)21;;/h2-3,5-6,9,16-17H,1H2,(H2,19,20,21)(H3,11,13,14,18);;/q;2*+1/p-2/t3-,5-,6-,9-;;/m1../s1 |
| InChIKey | PVBRXXAAPNGWGE-LGVAUZIVSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| disodium 5'-guanylate (CHEBI:132932) has part guanosine 5'-monophosphate(2−) (CHEBI:58115) |
| disodium 5'-guanylate (CHEBI:132932) has role flavouring agent (CHEBI:35617) |
| disodium 5'-guanylate (CHEBI:132932) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 5'-O-phosphonatoguanosine |
| Synonyms | Source |
|---|---|
| disodium guanylate | ChemIDplus |
| GMP disodium salt | ChemIDplus |
| 5-guanylic acid disodium salt | ChemIDplus |
| 5'-gmp disodium salt | ChemIDplus |
| guanosine 5'-phosphate disodium salt | ChemIDplus |
| disodium guanosine-5'-monophosphate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Disodium_guanylate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:5550-12-9 | ChemIDplus |
| Citations |
|---|