EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32O2 |
| Net Charge | 0 |
| Average Mass | 316.485 |
| Monoisotopic Mass | 316.24023 |
| SMILES | [H][C@]12CC[C@@]1([H])[C@@]1([H])[C@]2([H])[C@]2([H])[C@@]3([H])C[C@H](CCCCCCCC(=O)OC)[C@@]3([H])[C@@]21[H] |
| InChI | InChI=1S/C21H32O2/c1-23-16(22)8-6-4-2-3-5-7-12-11-15-17(12)21-19-14-10-9-13(14)18(19)20(15)21/h12-15,17-21H,2-11H2,1H3/t12-,13-,14+,15-,17+,18+,19-,20-,21+/m0/s1 |
| InChIKey | KEHCOLZYLZEADP-RRKMFVJESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl (+)-pentacycloanammoxate (CHEBI:132928) has functional parent (+)-pentacycloanammoxic acid (CHEBI:132927) |
| methyl (+)-pentacycloanammoxate (CHEBI:132928) has functional parent octanoic acid (CHEBI:28837) |
| methyl (+)-pentacycloanammoxate (CHEBI:132928) is a carbocyclic fatty acid (CHEBI:35744) |
| methyl (+)-pentacycloanammoxate (CHEBI:132928) is a fatty acid methyl ester (CHEBI:4986) |
| methyl (+)-pentacycloanammoxate (CHEBI:132928) is a ladderane (CHEBI:85034) |
| IUPAC Name |
|---|
| methyl 8-[(1S,2R,3R,4S,6S,7S,8S,9S,12R)-pentacyclo[6.4.0.02,7.03,6.09,12]dodecan-4-yl]octanoate |
| Synonyms | Source |
|---|---|
| C20-[5]-ladderane fatty acid methyl ester | ChEBI |
| methyl 8-(pentacyclo[6.4.0.02,7.03,6.09,12]dodec-4-yl)octanoate | ChEBI |
| methyl pentacycloanammoxate | ChEBI |
| (+)-pentacycloanammoxic acid methyl ester | ChEBI |
| pentacycloanammoxic acid methyl ester | ChEBI |
| Citations |
|---|