EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H30O2 |
| Net Charge | 0 |
| Average Mass | 242.403 |
| Monoisotopic Mass | 242.22458 |
| SMILES | CCCCC(C)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H30O2/c1-3-4-11-14(2)12-9-7-5-6-8-10-13-15(16)17/h14H,3-13H2,1-2H3,(H,16,17) |
| InChIKey | FDPYUFACKYXEAP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-methyltetradecanoic acid (CHEBI:132910) has functional parent tetradecanoic acid (CHEBI:28875) |
| 10-methyltetradecanoic acid (CHEBI:132910) is a branched-chain saturated fatty acid (CHEBI:39417) |
| 10-methyltetradecanoic acid (CHEBI:132910) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| 10-methyltetradecanoic acid |
| Synonym | Source |
|---|---|
| 10-methylmyristic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1772688 | Reaxys |