EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O3 |
| Net Charge | 0 |
| Average Mass | 256.386 |
| Monoisotopic Mass | 256.20384 |
| SMILES | [H][C@@]12[C@@H](O)[C@H](C(C)C)CC[C@@]1(C)[C@H](O)CC[C@]2(C)O |
| InChI | InChI=1S/C15H28O3/c1-9(2)10-5-7-14(3)11(16)6-8-15(4,18)13(14)12(10)17/h9-13,16-18H,5-8H2,1-4H3/t10-,11+,12-,13+,14-,15-/m0/s1 |
| InChIKey | SFPWDWLORNWKSK-DEPYFDJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cordia trichotoma (ncbitaxon:181186) | heartwood (PO:0004512) | PubMed (15018045) | |
| Homalomena occulta (ncbitaxon:714477) | aerial part (BTO:0001658) | PubMed (17511005) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mucrolidin (CHEBI:132907) has role plant metabolite (CHEBI:76924) |
| mucrolidin (CHEBI:132907) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| mucrolidin (CHEBI:132907) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,4S,4aS,5S,6S,8aR)-4,8a-dimethyl-6-(propan-2-yl)decahydronaphthalene-1,4,5-triol |
| Synonyms | Source |
|---|---|
| 1β,4β,6α-trihydroxyeudesmane | ChEBI |
| 1β,4β,6α-eudesmanetriol | ChEBI |
| (+)-1β,4β,6α-trihydroxyeudesmane | ChEBI |
| (+)-1β,4β,6α-eudesmanetriol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8273750 | Reaxys |
| Citations |
|---|