EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O |
| Net Charge | 0 |
| Average Mass | 222.372 |
| Monoisotopic Mass | 222.19837 |
| SMILES | [H][C@]12CCC(C)=C[C@@]1([H])[C@H](C(C)C)CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O/c1-10(2)12-7-8-15(4,16)14-6-5-11(3)9-13(12)14/h9-10,12-14,16H,5-8H2,1-4H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | LHYHMMRYTDARSZ-AJNGGQMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Calocedrus macrolepis (ncbitaxon:103965) | leaf (BTO:0000713) | PubMed (18206367) | |
| Chamaecyparis obtusa (ncbitaxon:13415) | heartwood (PO:0004512) | DOI (10.1007/s10086-012-1280-8) | |
| Chiliadenus lopadusanus (ncbitaxon:1548557) | |||
| flower (BTO:0000469) | PubMed (24079193) | ||
| leaf (BTO:0000713) | PubMed (24079193) | ||
| Cunninghamia konishii (ncbitaxon:66170) | heartwood (PO:0004512) | PubMed (22129092) | |
| Homalomena aromatica (ncbitaxon:1804071) | rhizome (BTO:0001181) | PubMed (23177818) | |
| Streptomyces sp. M491 (ncbitaxon:345410) | - | PubMed (19072130) |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. fungicide A substance used to destroy fungal pests. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-Τ-muurolol (CHEBI:132906) has role bacterial metabolite (CHEBI:76969) |
| (−)-Τ-muurolol (CHEBI:132906) has role fungicide (CHEBI:24127) |
| (−)-Τ-muurolol (CHEBI:132906) has role marine metabolite (CHEBI:76507) |
| (−)-Τ-muurolol (CHEBI:132906) has role plant metabolite (CHEBI:76924) |
| (−)-Τ-muurolol (CHEBI:132906) has role volatile oil component (CHEBI:27311) |
| (−)-Τ-muurolol (CHEBI:132906) is a cadinane sesquiterpenoid (CHEBI:22975) |
| (−)-Τ-muurolol (CHEBI:132906) is a carbobicyclic compound (CHEBI:36785) |
| (−)-Τ-muurolol (CHEBI:132906) is a octahydronaphthalenes (CHEBI:138397) |
| (−)-Τ-muurolol (CHEBI:132906) is a tertiary alcohol (CHEBI:26878) |
| (−)-Τ-muurolol (CHEBI:132906) is enantiomer of (+)-Τ-muurolol (CHEBI:63704) |
| Incoming Relation(s) |
| (+)-Τ-muurolol (CHEBI:63704) is enantiomer of (−)-Τ-muurolol (CHEBI:132906) |
| IUPAC Name |
|---|
| (1S,4S,4aR,8aS)-4-isopropyl-1,6-dimethyl-1,2,3,4,4a,7,8,8a-octahydronaphthalen-1-ol |
| Synonyms | Source |
|---|---|
| 10-epi-α-muurolol | NIST Chemistry WebBook |
| epi-α-muurolol | NIST Chemistry WebBook |
| epi-alpha-Muurolol | KNApSAcK |
| T-Muurolol | ChemIDplus |
| α-epi-muurolol | NIST Chemistry WebBook |
| (−)-τ-muurolol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00020154 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2210160 | Reaxys |
| CAS:19912-62-0 | NIST Chemistry WebBook |
| CAS:19912-62-0 | ChemIDplus |
| Citations |
|---|