EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O3 |
| Net Charge | 0 |
| Average Mass | 256.386 |
| Monoisotopic Mass | 256.20384 |
| SMILES | [H][C@@]12[C@@H](CC(C)(C)O)CC[C@@]1(C)[C@H](O)CC[C@]2(C)O |
| InChI | InChI=1S/C15H28O3/c1-13(2,17)9-10-5-7-14(3)11(16)6-8-15(4,18)12(10)14/h10-12,16-18H,5-9H2,1-4H3/t10-,11-,12-,14+,15+/m1/s1 |
| InChIKey | JQHTXZNYHSCIFE-FPVZYODXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus calamus (ncbitaxon:4465) | - | PubMed (23373216) | |
| Annona (ncbitaxon:13336) | leaf (BTO:0000713) | Article (Phytochemistry, 1985, 24(11), 2724) | Isolated from leaves of Annona bullata |
| Chimonanthus praecox (ncbitaxon:13419) | |||
| fruit (BTO:0000486) | Article (Phytochem Lett., 2011, 4(3), 271-274) | ||
| leaf (BTO:0000713) | Article (Phytochem Lett., 2011, 4(3), 271-274) | ||
| Homalomena aromatica (ncbitaxon:1804071) | root (BTO:0001188) | PubMed (1368861) | |
| Homalomena occulta (ncbitaxon:714477) | rhizome (BTO:0001181) | PubMed (22573367) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bullatantriol (CHEBI:132904) has functional parent oppsit-4(15)-ene-1beta,11-diol (CHEBI:69848) |
| bullatantriol (CHEBI:132904) has role plant metabolite (CHEBI:76924) |
| bullatantriol (CHEBI:132904) is a carbobicyclic compound (CHEBI:36785) |
| bullatantriol (CHEBI:132904) is a secondary alcohol (CHEBI:35681) |
| bullatantriol (CHEBI:132904) is a sesquiterpenoid (CHEBI:26658) |
| bullatantriol (CHEBI:132904) is a tertiary alcohol (CHEBI:26878) |
| bullatantriol (CHEBI:132904) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,3aR,4R,7S,7aR)-1-(2-hydroxy-2-methylpropyl)-3a,7-dimethyloctahydro-1H-indene-4,7-diol |
| Synonym | Source |
|---|---|
| (+)-bullatantriol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5808002 | Reaxys |
| Citations |
|---|