EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]12CC(C(C)C)=CC[C@@]1(C)[C@H](O)CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O2/c1-10(2)11-5-7-14(3)12(9-11)15(4,17)8-6-13(14)16/h5,10,12-13,16-17H,6-9H2,1-4H3/t12-,13-,14-,15+/m1/s1 |
| InChIKey | SOZSXJHFVBBAOY-TUVASFSCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chimonanthus praecox (ncbitaxon:13419) | |||
| fruit (BTO:0000486) | Article (Phytochem Lett., 2011, 4(3), 271-274) | ||
| leaf (BTO:0000713) | Article (Phytochem Lett., 2011, 4(3), 271-274) | ||
| Homalomena occulta (ncbitaxon:714477) | rhizome (BTO:0001181) | PubMed (18649899) | |
| Magnolia biondii (ncbitaxon:86725) | - | PubMed (19370929) | Found in buds |
| Chloranthus japonicus (ncbitaxon:13007) | whole plant (BTO:0001461) | DOI (http://dx.doi.org/10.1016/j.phytol.2016.01.005) | |
| Illicium oligandrum (ncbitaxon:145286) | root (BTO:0001188) | PubMed (25966312) | |
| Renealmia thyrsoidea (ncbitaxon:199659) | leaf (BTO:0000713) | PubMed (25251262) | |
| Hedychium spicatum (ncbitaxon:110723) | rhizome (BTO:0001181) | PubMed (23422227) | |
| Artemisia japonica (ncbitaxon:223868) | aerial part (BTO:0001658) | PubMed (11440075) | |
| Renealmia cincinnata (ncbitaxon:376570) | fruit (BTO:0000486) | PubMed (10643672) | |
| Homalomena aromatica (ncbitaxon:1804071) | root (BTO:0001188) | PubMed (1368861) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oplodiol (CHEBI:132903) has role plant metabolite (CHEBI:76924) |
| oplodiol (CHEBI:132903) is a carbobicyclic compound (CHEBI:36785) |
| oplodiol (CHEBI:132903) is a octahydronaphthalenes (CHEBI:138397) |
| oplodiol (CHEBI:132903) is a secondary alcohol (CHEBI:35681) |
| oplodiol (CHEBI:132903) is a sesquiterpenoid (CHEBI:26658) |
| oplodiol (CHEBI:132903) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,4R,4aR,8aR)-7-isopropyl-1,4a-dimethyl-1,2,3,4,4a,5,8,8a-octahydronaphthalene-1,4-diol |
| Synonyms | Source |
|---|---|
| (−)-oplodiol | KNApSAcK |
| [1S-(1α,4α,4aα,8aβ)]-1,2,3,4,4a,5,8,8a-octahydro-1,4a-dimethyl-7-(1-methylethyl)-1,4-naphthalenediol | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C00012788 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2106358 | Reaxys |
| CAS:13902-62-0 | ChemIDplus |
| Citations |
|---|