EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O3 |
| Net Charge | 0 |
| Average Mass | 256.386 |
| Monoisotopic Mass | 256.20384 |
| SMILES | [H][C@@]12C[C@](O)(C(C)C)CC[C@@]1(C)[C@H](O)CC[C@]2(C)O |
| InChI | InChI=1S/C15H28O3/c1-10(2)15(18)8-7-13(3)11(9-15)14(4,17)6-5-12(13)16/h10-12,16-18H,5-9H2,1-4H3/t11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | HZQODNRPUJAVLV-ZSAUSMIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acorus calamus (ncbitaxon:4465) | - | PubMed (23373216) | |
| Cordia trichotoma (ncbitaxon:181186) | heartwood (PO:0004512) | PubMed (15018045) | |
| Homalomena occulta (ncbitaxon:714477) | aerial part (BTO:0001658) | PubMed (17511005) | |
| Teucrium ramosissimum (IPNI:460664-1) | aerial part (BTO:0001658) | PubMed (19766274) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1β,4β,7α-trihydroxyeudesmane (CHEBI:132902) has role plant metabolite (CHEBI:76924) |
| 1β,4β,7α-trihydroxyeudesmane (CHEBI:132902) is a eudesmane sesquiterpenoid (CHEBI:62508) |
| 1β,4β,7α-trihydroxyeudesmane (CHEBI:132902) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,4S,4aR,6S,8aR)-4,8a-dimethyl-6-(propan-2-yl)decahydronaphthalene-1,4,6-triol |
| Synonyms | Source |
|---|---|
| 1,4,7-eudesmanetriol | SUBMITTER |
| (-)-1beta,4beta,7alpha-Trihydroxyeudesmane | KNApSAcK |
| 1β,4β,7α-eudesmanetriol | ChEBI |
| eudesmane-1,4,7-triol | ChEBI |
| eudesmane-1β,4β,7α-triol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00033538 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5808101 | Reaxys |
| CAS:145400-02-8 | KNApSAcK |
| Citations |
|---|