EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O2 |
| Net Charge | 0 |
| Average Mass | 238.371 |
| Monoisotopic Mass | 238.19328 |
| SMILES | [H][C@@]12[C@@H](CC(=C)C)CC[C@@]1(C)[C@H](O)CC[C@]2(C)O |
| InChI | InChI=1S/C15H26O2/c1-10(2)9-11-5-7-14(3)12(16)6-8-15(4,17)13(11)14/h11-13,16-17H,1,5-9H2,2-4H3/t11-,12-,13-,14+,15+/m1/s1 |
| InChIKey | PECCCWAOADXQBC-ZSAUSMIDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homalomena aromatica (ncbitaxon:1804071) | root (BTO:0001188) | PubMed (1368861) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-homalomenol B (CHEBI:132901) has role plant metabolite (CHEBI:76924) |
| (+)-homalomenol B (CHEBI:132901) is a carbobicyclic compound (CHEBI:36785) |
| (+)-homalomenol B (CHEBI:132901) is a diol (CHEBI:23824) |
| (+)-homalomenol B (CHEBI:132901) is a olefinic compound (CHEBI:78840) |
| (+)-homalomenol B (CHEBI:132901) is a secondary alcohol (CHEBI:35681) |
| (+)-homalomenol B (CHEBI:132901) is a sesquiterpenoid (CHEBI:26658) |
| (+)-homalomenol B (CHEBI:132901) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1R,3aR,4R,7S,7aR)-3a,7-dimethyl-1-(2-methylprop-2-en-1-yl)octahydro-1H-indene-4,7-diol |
| Synonym | Source |
|---|---|
| homalomenol B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5810044 | Reaxys |
| CAS:145400-04-0 | ChemIDplus |
| Citations |
|---|