EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H40N2O6 |
| Net Charge | 0 |
| Average Mass | 608.735 |
| Monoisotopic Mass | 608.28864 |
| SMILES | [H][C@]12Cc3ccc(OC)c(c3)Oc3ccc(cc3)C[C@H]3c4cc(c(OC)cc4CCN3C)Oc3c(O)c(OC)cc(c31)CCN2C |
| InChI | InChI=1S/C37H40N2O6/c1-38-14-12-24-19-31(42-4)33-21-27(24)28(38)16-22-6-9-26(10-7-22)44-32-18-23(8-11-30(32)41-3)17-29-35-25(13-15-39(29)2)20-34(43-5)36(40)37(35)45-33/h6-11,18-21,28-29,40H,12-17H2,1-5H3/t28-,29-/m0/s1 |
| InChIKey | IIQSJHUEZBTSAT-VMPREFPWSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stephania tetrandra (ncbitaxon:425106) | root (BTO:0001188) | PubMed (20030508) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. anti-HIV-1 agent An anti-HIV agent that destroys or inhibits the replication of HIV-1, the more infective and more virulent of the two types of HIV virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fangchinoline (CHEBI:132893) has role anti-HIV-1 agent (CHEBI:64947) |
| fangchinoline (CHEBI:132893) has role anti-inflammatory agent (CHEBI:67079) |
| fangchinoline (CHEBI:132893) has role antineoplastic agent (CHEBI:35610) |
| fangchinoline (CHEBI:132893) has role antioxidant (CHEBI:22586) |
| fangchinoline (CHEBI:132893) has role neuroprotective agent (CHEBI:63726) |
| fangchinoline (CHEBI:132893) has role plant metabolite (CHEBI:76924) |
| fangchinoline (CHEBI:132893) is a aromatic ether (CHEBI:35618) |
| fangchinoline (CHEBI:132893) is a bisbenzylisoquinoline alkaloid (CHEBI:133004) |
| fangchinoline (CHEBI:132893) is a macrocycle (CHEBI:51026) |
| IUPAC Name |
|---|
| (1β)-6,6',12-trimethoxy-2,2'-dimethylberbaman-7-ol |
| Synonyms | Source |
|---|---|
| (1β)-2,2'-dimethyl-6,6',12-trimethoxyberbaman-7-ol | ChemIDplus |
| 7-O-demethyltetrandrine | ChemIDplus |
| (+)-fangchinoline | ChemIDplus |
| (+)-limacine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Fangchinoline | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:78975 | Reaxys |
| CAS:436-77-1 | ChemIDplus |
| Citations |
|---|