EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C2H8N.C9H5ClNO3S |
| Net Charge | 0 |
| Average Mass | 288.756 |
| Monoisotopic Mass | 288.03354 |
| SMILES | C[NH2+]C.O=C([O-])Cn1c(=O)sc2cccc(Cl)c21 |
| InChI | InChI=1S/C9H6ClNO3S.C2H7N/c10-5-2-1-3-6-8(5)11(4-7(12)13)9(14)15-6;1-3-2/h1-3H,4H2,(H,12,13);3H,1-2H3 |
| InChIKey | KKTYYONKWVCNJI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benazolin-dimethylammonium (CHEBI:132891) has part benazolin(1−) (CHEBI:132890) |
| benazolin-dimethylammonium (CHEBI:132891) has part dimethylaminium (CHEBI:58040) |
| benazolin-dimethylammonium (CHEBI:132891) has role agrochemical (CHEBI:33286) |
| benazolin-dimethylammonium (CHEBI:132891) has role herbicide (CHEBI:24527) |
| benazolin-dimethylammonium (CHEBI:132891) has role synthetic auxin (CHEBI:26841) |
| benazolin-dimethylammonium (CHEBI:132891) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| N-methylmethanaminium (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetate |
| Synonyms | Source |
|---|---|
| dimethylammonium 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetate | Alan Wood's Pesticides |
| 4-chloro-2,3-dihydro-2-oxo-1,3-benzothiazol-3-ylacetic acid - dimethylamine (1:1) | Alan Wood's Pesticides |
| 4-chloro-2-oxo-3(2H)-benzothiazoleacetic acid compound with N-methylmethanamine (1:1) | Alan Wood's Pesticides |
| (4-chloro-2-oxo-1,3-benzothiazol-3(2H)-yl)acetic acid—N-methylmethanamine (1/1) | Alan Wood's Pesticides |
| benazolin dimethylamine salt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| benazolin-dimethylammonium | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| CAS:38561-76-1 | Alan Wood's Pesticides |
| CAS:38561-76-1 | ChemIDplus |