EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H7Cl2NO2 |
| Net Charge | 0 |
| Average Mass | 256.088 |
| Monoisotopic Mass | 254.98538 |
| SMILES | COC(=O)c1c(Cl)ccc2cc(Cl)cnc12 |
| InChI | InChI=1S/C11H7Cl2NO2/c1-16-11(15)9-8(13)3-2-6-4-7(12)5-14-10(6)9/h2-5H,1H3 |
| InChIKey | LNKVWJBNESETCJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | agrochemical An agrochemical is a substance that is used in agriculture or horticulture. herbicide A substance used to destroy plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinclorac-methyl (CHEBI:132879) has functional parent quinclorac (CHEBI:81974) |
| quinclorac-methyl (CHEBI:132879) has role agrochemical (CHEBI:33286) |
| quinclorac-methyl (CHEBI:132879) has role herbicide (CHEBI:24527) |
| quinclorac-methyl (CHEBI:132879) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| methyl 3,7-dichloroquinoline-8-carboxylate |
| Synonyms | Source |
|---|---|
| quinclorac methyl ester | ChemIDplus |
| methyl 3,7-bis(chloranyl)quinoline-8-carboxylate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:84087-33-2 | ChemIDplus |
| Citations |
|---|