EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O6 |
| Net Charge | 0 |
| Average Mass | 308.330 |
| Monoisotopic Mass | 308.12599 |
| SMILES | CCCCC(COC(=O)c1ccccc1C(=O)O)CC(=O)O |
| InChI | InChI=1S/C16H20O6/c1-2-3-6-11(9-14(17)18)10-22-16(21)13-8-5-4-7-12(13)15(19)20/h4-5,7-8,11H,2-3,6,9-10H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | CCNOZWPVQWCJFK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mono[2-(carboxymethyl)hexyl] phthalate (CHEBI:132874) has role human urinary metabolite (CHEBI:84087) |
| mono[2-(carboxymethyl)hexyl] phthalate (CHEBI:132874) has role human xenobiotic metabolite (CHEBI:76967) |
| mono[2-(carboxymethyl)hexyl] phthalate (CHEBI:132874) is a dicarboxylic acid (CHEBI:35692) |
| mono[2-(carboxymethyl)hexyl] phthalate (CHEBI:132874) is a phthalic acid monoester (CHEBI:132610) |
| IUPAC Name |
|---|
| 2-({[2-(carboxymethyl)hexyl]oxy}carbonyl)benzoic acid |
| Synonyms | Source |
|---|---|
| 1,2-Benzenedicarboxylic acid, 1-(2-(carboxymethyl)hexyl) ester | ChemIDplus |
| mono-2-(carboxymethyl)hexyl phthalate | ChEBI |
| phthalic acid 1-(2-(carboxymethyl)hexyl) ester | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:26026109 | Reaxys |
| CAS:82975-93-7 | ChemIDplus |
| Citations |
|---|