EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O3 |
| Net Charge | 0 |
| Average Mass | 254.370 |
| Monoisotopic Mass | 254.18819 |
| SMILES | [H][C@]12O[C@](O)(CC[C@@]1(C)O)[C@@]1(C)CC[C@]([H])(C(C)C)[C@]12[H] |
| InChI | InChI=1S/C15H26O3/c1-9(2)10-5-6-13(3)11(10)12-14(4,16)7-8-15(13,17)18-12/h9-12,16-17H,5-8H2,1-4H3/t10-,11+,12-,13+,14-,15-/m1/s1 |
| InChIKey | DHUDRGOPTAAHRB-ARSDKDGVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chimonanthus praecox (ncbitaxon:13419) | |||
| fruit (BTO:0000486) | Article (Phytochem Lett., 2011, 4(3), 271-274) | ||
| leaf (BTO:0000713) | Article (Phytochem Lett., 2011, 4(3), 271-274) | ||
| Homalomena aromatica (ncbitaxon:1804071) | root (BTO:0001188) | Article (Phytochemistry, 1992, 31(5), 1659-1661) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-homalomenol C (CHEBI:132870) has role plant metabolite (CHEBI:76924) |
| (−)-homalomenol C (CHEBI:132870) is a lactol (CHEBI:38131) |
| (−)-homalomenol C (CHEBI:132870) is a organic heterotricyclic compound (CHEBI:26979) |
| (−)-homalomenol C (CHEBI:132870) is a sesquiterpenoid (CHEBI:26658) |
| (−)-homalomenol C (CHEBI:132870) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| rel-(1R,2S,5R,6R,7R,8R)-5-isopropyl-2,8-dimethyl-11-oxatricyclo[5.3.1.02,6]undecane-1,8-diol |
| Synonym | Source |
|---|---|
| homalomenol C | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00033918 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5426860 | Reaxys |