EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO3 |
| Net Charge | 0 |
| Average Mass | 147.174 |
| Monoisotopic Mass | 147.08954 |
| SMILES | C[C@@H]1NC[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13NO3/c1-3-5(9)6(10)4(8)2-7-3/h3-10H,2H2,1H3/t3-,4+,5+,6-/m0/s1 |
| InChIKey | VYOCYWDJTQRZLC-KCDKBNATSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium proliferatum (ncbitaxon:948311) | - | PubMed (27984201) |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deoxyfuconojirimycin (CHEBI:132866) has role fungal metabolite (CHEBI:76946) |
| deoxyfuconojirimycin (CHEBI:132866) is a hydroxypiperidine (CHEBI:48590) |
| deoxyfuconojirimycin (CHEBI:132866) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2S,3R,4S,5R)-2-methylpiperidine-3,4,5-triol |
| Synonyms | Source |
|---|---|
| 1,2,6-Trideoxy-2,6-imino-D-galactitol | ChemIDplus |
| 1,5-Dideoxy-1,5-iminofucitol | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4174699 | Reaxys |
| CAS:99212-30-3 | ChemIDplus |
| Citations |
|---|