EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O6 |
| Net Charge | 0 |
| Average Mass | 294.303 |
| Monoisotopic Mass | 294.11034 |
| SMILES | [H][C@]12OC[C@@]3(O)[C@@H]4O[C@@H]4[C@](O)([C@@]13C)[C@@]1([H])C(=O)O[C@]2([H])[C@H]1C(=C)C |
| InChI | InChI=1S/C15H18O6/c1-5(2)6-7-12(16)20-8(6)9-13(3)14(17,4-19-9)10-11(21-10)15(7,13)18/h6-11,17-18H,1,4H2,2-3H3/t6-,7+,8+,9+,10+,11-,13-,14+,15-/m0/s1 |
| InChIKey | IKTUZVAVHCTHSU-ULZPOIKGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coriaria ruscifolia (ncbitaxon:79762) | fruit (BTO:0000486) | PubMed (11429254) | |
| Loranthus parasiticus ( L. ) Merr. (IPNI:549945-1) | fruit (BTO:0000486) | PubMed (24467533) | |
| Coriaria japonica (ncbitaxon:79757) | fruit (BTO:0000486) | PubMed (16079545) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| corianin (CHEBI:132864) has role plant metabolite (CHEBI:76924) |
| corianin (CHEBI:132864) is a bridged compound (CHEBI:35990) |
| corianin (CHEBI:132864) is a diol (CHEBI:23824) |
| corianin (CHEBI:132864) is a epoxide (CHEBI:32955) |
| corianin (CHEBI:132864) is a organic heteropentacyclic compound (CHEBI:38164) |
| corianin (CHEBI:132864) is a sesquiterpene lactone (CHEBI:37667) |
| corianin (CHEBI:132864) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2aS,3R,6S,6aR,6bS,7aR,7bR,7cR,8R)-6a,7b-dihydroxy-7c-methyl-8-(prop-1-en-2-yl)octahydro-3,6-methano-2,4,7-trioxacyclopenta[cd]cyclopropa[a]azulen-5(1H)-one |
| Manual Xrefs | Databases |
|---|---|
| C00021364 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1260590 | Reaxys |
| CAS:35481-77-7 | ChemIDplus |
| Citations |
|---|