EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O6 |
| Net Charge | 0 |
| Average Mass | 296.319 |
| Monoisotopic Mass | 296.12599 |
| SMILES | [H][C@@]12C(=O)O[C@@]([H])(C[C@]3(C)[C@@]1(O)[C@H]1O[C@H]1[C@]31CO1)[C@@]2([H])C(C)(C)O |
| InChI | InChI=1S/C15H20O6/c1-12(2,17)7-6-4-13(3)14(5-19-14)9-10(21-9)15(13,18)8(7)11(16)20-6/h6-10,17-18H,4-5H2,1-3H3/t6-,7+,8+,9+,10-,13-,14+,15-/m0/s1 |
| InChIKey | LGZSARJAXHVXEV-YEJVQPDVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coriaria nepalensis Wall. (IPNI:271362-1) | root (BTO:0001188) | PubMed (12016873) | |
| Loranthus parasiticus ( L. ) Merr. (IPNI:549945-1) | - | PubMed (24467533) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| coriatin (CHEBI:132863) has role plant metabolite (CHEBI:76924) |
| coriatin (CHEBI:132863) is a bridged compound (CHEBI:35990) |
| coriatin (CHEBI:132863) is a diol (CHEBI:23824) |
| coriatin (CHEBI:132863) is a organic heterotetracyclic compound (CHEBI:38163) |
| coriatin (CHEBI:132863) is a sesquiterpene lactone (CHEBI:37667) |
| coriatin (CHEBI:132863) is a spiro-epoxide (CHEBI:133131) |
| coriatin (CHEBI:132863) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (1S,2R,3S,5R,6R,7R,9S,12S)-2-hydroxy-12-(2-hydroxypropan-2-yl)-7-methyl-11H-spiro[4,10-dioxatetracyclo[7.2.1.02,7.03,5]dodecane-6,2'-oxiran]-11-one |
| Citations |
|---|