EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O3 |
| Net Charge | 0 |
| Average Mass | 200.278 |
| Monoisotopic Mass | 200.14124 |
| SMILES | C=CC(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C11H20O3/c1-2-10(12)8-6-4-3-5-7-9-11(13)14/h2,10,12H,1,3-9H2,(H,13,14) |
| InChIKey | CJUFNYIRKDOQMC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Corchorus olitorius (ncbitaxon:93759) | leaf (BTO:0000713) | Article (Chem. Pharm. Bull, 1998, 46, 1008-1014) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9-hydroxyundec-10-enoic acid (CHEBI:132854) is a hydroxy monounsaturated fatty acid (CHEBI:131869) |
| 9-hydroxyundec-10-enoic acid (CHEBI:132854) is a medium-chain fatty acid (CHEBI:59554) |
| 9-hydroxyundec-10-enoic acid (CHEBI:132854) is a olefinic fatty acid (CHEBI:53339) |
| 9-hydroxyundec-10-enoic acid (CHEBI:132854) is a secondary alcohol (CHEBI:35681) |
| Synonym | Source |
|---|---|
| corchorifatty acid E | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1774484 | Reaxys |