EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O2 |
| Net Charge | 0 |
| Average Mass | 440.712 |
| Monoisotopic Mass | 440.36543 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@H](C(=C)C)[C@]2(C)CCC(=O)O |
| InChI | InChI=1S/C30H48O2/c1-19(2)22-12-16-30(8)24(28(22,6)15-13-25(31)32)10-9-23-26-21(4)20(3)11-14-27(26,5)17-18-29(23,30)7/h9,20-22,24,26H,1,10-18H2,2-8H3,(H,31,32)/t20-,21+,22+,24-,26+,27-,28+,29-,30-/m1/s1 |
| InChIKey | RPPYCVULPFKBOG-CSHKLQQTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gentiana macrophylla (ncbitaxon:50765) | root (BTO:0001188) | PubMed (16335823) | |
| Gentiana dahurica (ncbitaxon:225203) | root (BTO:0001188) | PubMed (22233034) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| roburic acid (CHEBI:132851) has role plant metabolite (CHEBI:76924) |
| roburic acid (CHEBI:132851) is a monocarboxylic acid (CHEBI:25384) |
| roburic acid (CHEBI:132851) is a olefinic compound (CHEBI:78840) |
| roburic acid (CHEBI:132851) is a tetracyclic triterpenoid (CHEBI:26893) |
| IUPAC Name |
|---|
| 3-[(1S,2S,4aR,4bS,6aR,9R,10S,10aR,12aR)-1,4a,4b,6a,9,10-hexamethyl-2-(prop-1-en-2-yl)-1,2,3,4,4a,4b,5,6,6a,7,8,9,10,10a,12,12a-hexadecahydrochrysen-1-yl]propanoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2488188 | Reaxys |
| Citations |
|---|