EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14O3 |
| Net Charge | 0 |
| Average Mass | 158.197 |
| Monoisotopic Mass | 158.09429 |
| SMILES | CC/C=C\CCOC(=O)OC |
| InChI | InChI=1S/C8H14O3/c1-3-4-5-6-7-11-8(9)10-2/h4-5H,3,6-7H2,1-2H3/b5-4- |
| InChIKey | BLOXMGXSDAAJGX-PLNGDYQASA-N |
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Application: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-hex-3-en-1-yl methyl carbonate (CHEBI:132845) has functional parent (Z)-hex-3-en-1-ol (CHEBI:28857) |
| (Z)-hex-3-en-1-yl methyl carbonate (CHEBI:132845) has role flavouring agent (CHEBI:35617) |
| (Z)-hex-3-en-1-yl methyl carbonate (CHEBI:132845) is a carbonate ester (CHEBI:46722) |
| (Z)-hex-3-en-1-yl methyl carbonate (CHEBI:132845) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| (3Z)-hex-3-en-1-yl methyl carbonate |
| Synonyms | Source |
|---|---|
| cis-hex-3-en-1-yl methyl carbonate | ChEBI |
| cis-3-hexenyl methyl carbonate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11333065 | Reaxys |
| CAS:67633-96-9 | PubChem Compound |