EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H14O3 |
| Net Charge | 0 |
| Average Mass | 146.186 |
| Monoisotopic Mass | 146.09429 |
| SMILES | CCCCC(O)CC(=O)O |
| InChI | InChI=1S/C7H14O3/c1-2-3-4-6(8)5-7(9)10/h6,8H,2-5H2,1H3,(H,9,10) |
| InChIKey | OXSSIXNFGTZQMZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxyheptanoic acid (CHEBI:132838) has functional parent heptanoic acid (CHEBI:45571) |
| 3-hydroxyheptanoic acid (CHEBI:132838) is a 3-hydroxy fatty acid (CHEBI:59845) |
| 3-hydroxyheptanoic acid (CHEBI:132838) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 3-hydroxyheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| HMDB0061653 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1755590 | Reaxys |