EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]12CC[C@]3(C)CCCC(C)=C3[C@]1([H])C2(C)C |
| InChI | InChI=1S/C15H24/c1-10-6-5-8-15(4)9-7-11-13(12(10)15)14(11,2)3/h11,13H,5-9H2,1-4H3/t11-,13-,15+/m1/s1 |
| InChIKey | UPGLJTCDRBIZKP-KYOSRNDESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Angelica dahurica (ncbitaxon:48101) | root (BTO:0001188) | PubMed (21657081) | |
| Artemisia monosperma (ncbitaxon:72348) | |||
| leaf (BTO:0000713) | PubMed (22978234) | ||
| stem (BTO:0001300) | PubMed (22978234) | ||
| Cyperus articulatus (ncbitaxon:1352543) | rhizome (BTO:0001181) | DOI (10.1080/10412905.2006.9699179) | |
| Nardostachys chinensis (ncbitaxon:179860) | - | PubMed (18404355) | Also known as Nardostachys jatamansi and Nardostachys grandiflora |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-maaliene (CHEBI:132831) has role plant metabolite (CHEBI:76924) |
| β-maaliene (CHEBI:132831) has role volatile oil component (CHEBI:27311) |
| β-maaliene (CHEBI:132831) is a carbotricyclic compound (CHEBI:38032) |
| β-maaliene (CHEBI:132831) is a polycyclic olefin (CHEBI:35714) |
| β-maaliene (CHEBI:132831) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (1aR,3aS,7bS)-1,1,3a,7-tetramethyl-1a,2,3,3a,4,5,6,7b-octahydro-1H-cyclopropa[a]naphthalene |
| Synonym | Source |
|---|---|
| beta-Maaliene | KNApSAcK |
| UniProt Name | Source |
|---|---|
| β-maaliene | UniProt |
| Citations |
|---|