EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | C=C[C@@]1(C)CCC(C(C)C)=C[C@@H]1C(=C)C |
| InChI | InChI=1S/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,10-11,14H,1,4,8-9H2,2-3,5-6H3/t14-,15+/m1/s1 |
| InChIKey | MXDMETWAEGIFOE-CABCVRRESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alisma orientale (ncbitaxon:262913) | tuber (BTO:0001400) | PubMed (26666273) | 12.4% of the essential oil |
| Canarium tramdenum (ncbitaxon:210350) | resin | PubMed (24443833) | |
| Centaurea formanekii Halácsy (IPNI:190516-1) | aerial part (BTO:0001658) | PubMed (22978235) | |
| Chamaecyparis lawsoniana (ncbitaxon:58030) | stem (BTO:0001300) | PubMed (23157017) | Found in the essential oil from stem & leaves |
| Commiphora holtziana (IPNI:127690-1) | gum resin | PubMed (18402993) | |
| Copaifera langsdorffiii (ncbitaxon:280048) | fruit (BTO:0000486) | PubMed (25588080) | |
| Eremanthus erythropappus (ncbitaxon:434655) | |||
| leaf (BTO:0000713) | PubMed (25970043) | ||
| branch (BTO:0000148) | PubMed (25970043) | ||
| Murraya exotica (ncbitaxon:159059) | |||
| leaf (BTO:0000713) | PubMed (24354205) | ||
| twig (BTO:0001411) | PubMed (24354205) | ||
| Murraya paniculata (ncbitaxon:43711) | |||
| twig (BTO:0001411) | PubMed (24354205) | ||
| leaf (BTO:0000713) | PubMed (24354205) | ||
| Solanum pseudocapsicum (ncbitaxon:45837) | root (BTO:0001188) | PubMed (17887952) | |
| Stachys cretica L. (IPNI:459450-1) | aerial part (BTO:0001658) | PubMed (19370886) | subsp. smyrnaea Rech. fil. 2.1% of the essential oil. |
| Vitex megapotamica (ncbitaxon:1365883) | leaf (BTO:0000713) | PubMed (22708620) | Found in the essential oil from the leaves |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-elemene (CHEBI:132830) has role apoptosis inducer (CHEBI:68495) |
| δ-elemene (CHEBI:132830) has role plant metabolite (CHEBI:76924) |
| δ-elemene (CHEBI:132830) is a cyclic olefin (CHEBI:33642) |
| δ-elemene (CHEBI:132830) is a monocyclic hydrocarbon (CHEBI:33664) |
| δ-elemene (CHEBI:132830) is a sesquiterpene (CHEBI:35189) |
| IUPAC Name |
|---|
| (3R,4R)-1-isopropyl-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexene |
| Synonyms | Source |
|---|---|
| (3R,trans)-1-isopropyl-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexene | ChEBI |
| (3R-trans)-4-ethenyl-4-methyl-3-(1-methylethenyl)-1-(1-methylethyl)-cyclohexene | ChemIDplus |
| (R,R)-1-isopropyl-4-methyl-3-(prop-1-en-2-yl)-4-vinylcyclohexene | ChEBI |
| UniProt Name | Source |
|---|---|
| (1R,2R)-δ-elemene | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9765819 | Reaxys |
| CAS:11029-06-4 | PubChem Compound |
| CAS:20307-84-0 | ChemIDplus |
| Citations |
|---|