EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | C=C1CCC(C(C)(C)OC(C)=O)CC1 |
| InChI | InChI=1S/C12H20O2/c1-9-5-7-11(8-6-9)12(3,4)14-10(2)13/h11H,1,5-8H2,2-4H3 |
| InChIKey | IWKXKWUCSZHJEK-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Laurus nobilis (ncbitaxon:85223) | leaf (BTO:0000713) | DOI (10.1080/10412905.2001.9699624) |
| Roles Classification |
|---|
| Biological Roles: | volatile oil component Any plant metabolite that is found naturally as a component of a volatile oil. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| δ-terpineol acetate (CHEBI:132829) has role plant metabolite (CHEBI:76924) |
| δ-terpineol acetate (CHEBI:132829) has role volatile oil component (CHEBI:27311) |
| δ-terpineol acetate (CHEBI:132829) is a p-menthane monoterpenoid (CHEBI:25186) |
| δ-terpineol acetate (CHEBI:132829) is a acetate ester (CHEBI:47622) |
| δ-terpineol acetate (CHEBI:132829) is a alicyclic compound (CHEBI:33654) |
| δ-terpineol acetate (CHEBI:132829) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 2-(4-methylidenecyclohexyl)propan-2-yl acetate |
| Synonyms | Source |
|---|---|
| terpiryl acetate | SUBMITTER |
| δ-terpenyl acetate | ChEBI |
| δ-terpinyl acetate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 91691738 | PubChem Compound |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6194029 | Reaxys |
| Citations |
|---|