EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18O2 |
| Net Charge | 0 |
| Average Mass | 182.263 |
| Monoisotopic Mass | 182.13068 |
| SMILES | [H]C(=O)O[C@@H]1C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C11H18O2/c1-10(2)8-4-5-11(10,3)9(6-8)13-7-12/h7-9H,4-6H2,1-3H3/t8-,9-,11+/m1/s1 |
| InChIKey | RDWUNORUTVEHJF-KKZNHRDASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cyrtopodium macrobulbon (ncbitaxon:1547852) | - | PubMed (24818583) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobornyl formate (CHEBI:132828) has functional parent borneol (CHEBI:28093) |
| isobornyl formate (CHEBI:132828) has role plant metabolite (CHEBI:76924) |
| isobornyl formate (CHEBI:132828) is a bornane monoterpenoid (CHEBI:22912) |
| isobornyl formate (CHEBI:132828) is a bridged compound (CHEBI:35990) |
| isobornyl formate (CHEBI:132828) is a formate ester (CHEBI:52343) |
| IUPAC Name |
|---|
| rel-(1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl formate |
| Synonyms | Source |
|---|---|
| Bornyl formate | SUBMITTER |
| Isoborneol formate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2011117740 | Patent |
| Citations |
|---|